About diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate
diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate (PubChem CID 157475406) has the molecular formula C17H35BrF2O9P2
and a molecular weight of 563.31 g/mol. Its IUPAC name is diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate.
Molecular Properties
| Compound Name | diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate |
| PubChem CID | 157475406 |
| Molecular Formula | C17H35BrF2O9P2 |
| Molecular Weight | 563.31 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)Br.CCOC(=O)C(F)P(=O)(OCC)OCC.CCOP(C)OCC |
| InChI | InChI=1S/C8H16FO5P.C5H13O2P.C4H6BrFO2/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3;1-4-6-8(3)7-5-2;1-2-8-4(7)3(5)6/h7H,4-6H2,1-3H3;4-5H2,1-3H3;3H,2H2,1H3 |
| InChIKey | BVNIFRZLFOCALU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate?
The IUPAC name of diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate (CID 157475406) is diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate.
What is the SMILES notation for diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate?
The canonical SMILES for diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate is CCOC(=O)C(F)Br.CCOC(=O)C(F)P(=O)(OCC)OCC.CCOP(C)OCC.
What is the InChIKey of diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate?
The InChIKey is BVNIFRZLFOCALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FO5P.C5H13O2P.C4H6BrFO2/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3;1-4-6-8(3)7-5-2;1-2-8-4(7)3(5)6/h7H,4-6H2,1-3H3;4-5H2,1-3H3;3H,2H2,1H3.
What are the key properties of diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate?
diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate has a molecular weight of 563.31 g/mol, XLogP of 5.35, 13 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(methyl)phosphane;ethyl 2-bromo-2-fluoroacetate;ethyl 2-diethoxyphosphoryl-2-fluoroacetate is sourced from PubChem (CID 157475406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).