C10H21F3O7P2 — CID 13026280
(1-diethoxyphosphoryl-2,2,2-trifluoroethyl) diethyl phosphate (PubChem CID 13026280) has the molecular formula C10H21F3O7P2 and a molecular weight of 372.21 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) diethyl phosphate.
| Compound Name | (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) diethyl phosphate |
|---|---|
| PubChem CID | 13026280 |
| Molecular Formula | C10H21F3O7P2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H21F3O7P2/c1-5-16-21(14,17-6-2)9(10(11,12)13)20-22(15,18-7-3)19-8-4/h9H,5-8H2,1-4H3 |
| InChIKey | DWDGISUGOSERQL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|