C12H23F3NO6P — CID 25108204
ethyl N-(4-diethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate (PubChem CID 25108204) has the molecular formula C12H23F3NO6P and a molecular weight of 365.29 g/mol. Its IUPAC name is ethyl N-(4-diethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate.
| Compound Name | ethyl N-(4-diethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate |
|---|---|
| PubChem CID | 25108204 |
| Molecular Formula | C12H23F3NO6P |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | ethyl N-(4-diethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate |
| SMILES | CCOC(=O)NC(C)CC(OP(=O)(OCC)OCC)C(F)(F)F |
| InChI | InChI=1S/C12H23F3NO6P/c1-5-19-11(17)16-9(4)8-10(12(13,14)15)22-23(18,20-6-2)21-7-3/h9-10H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | LTHWSTNSHMSPFR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|