C10H19F3NO6P — CID 25108208
ethyl N-(4-dimethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate (PubChem CID 25108208) has the molecular formula C10H19F3NO6P and a molecular weight of 337.23 g/mol. Its IUPAC name is ethyl N-(4-dimethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate.
| Compound Name | ethyl N-(4-dimethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate |
|---|---|
| PubChem CID | 25108208 |
| Molecular Formula | C10H19F3NO6P |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | ethyl N-(4-dimethoxyphosphoryloxy-5,5,5-trifluoropentan-2-yl)carbamate |
| SMILES | CCOC(=O)NC(C)CC(OP(=O)(OC)OC)C(F)(F)F |
| InChI | InChI=1S/C10H19F3NO6P/c1-5-19-9(15)14-7(2)6-8(10(11,12)13)20-21(16,17-3)18-4/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | GEPVXFTYRVVFHS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|