C12H18F8NO5P — CID 15194576
ethyl N-(1-diethoxyphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate (PubChem CID 15194576) has the molecular formula C12H18F8NO5P and a molecular weight of 439.24 g/mol. Its IUPAC name is ethyl N-(1-diethoxyphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate.
| Compound Name | ethyl N-(1-diethoxyphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
|---|---|
| PubChem CID | 15194576 |
| Molecular Formula | C12H18F8NO5P |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | ethyl N-(1-diethoxyphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
| SMILES | CCOC(=O)NC(C(F)(F)C(F)(F)C(F)(F)C(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H18F8NO5P/c1-4-24-9(22)21-8(27(23,25-5-2)26-6-3)11(17,18)12(19,20)10(15,16)7(13)14/h7-8H,4-6H2,1-3H3,(H,21,22) |
| InChIKey | BXBQHKOFGJLUTR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|