C8H15Cl3NO4P — CID 2305152
N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide (PubChem CID 2305152) has the molecular formula C8H15Cl3NO4P and a molecular weight of 326.54 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
|---|---|
| PubChem CID | 2305152 |
| Molecular Formula | C8H15Cl3NO4P |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
| SMILES | CCOP(=O)(OCC)[C@H](NC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H15Cl3NO4P/c1-4-15-17(14,16-5-2)7(8(9,10)11)12-6(3)13/h7H,4-5H2,1-3H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | BCAPMBHEXGUDJF-ZETCQYMHSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|