About N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide
N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide (PubChem CID 2305152) has the molecular formula C8H15Cl3NO4P
and a molecular weight of 326.54 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
| PubChem CID | 2305152 |
| Molecular Formula | C8H15Cl3NO4P |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide |
| SMILES | CCOP(=O)(OCC)[C@H](NC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H15Cl3NO4P/c1-4-15-17(14,16-5-2)7(8(9,10)11)12-6(3)13/h7H,4-5H2,1-3H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | BCAPMBHEXGUDJF-ZETCQYMHSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide?
The IUPAC name of N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide (CID 2305152) is N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide.
What is the SMILES notation for N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide?
The canonical SMILES for N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide is CCOP(=O)(OCC)[C@H](NC(C)=O)C(Cl)(Cl)Cl.
What is the InChIKey of N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide?
The InChIKey is BCAPMBHEXGUDJF-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H15Cl3NO4P/c1-4-15-17(14,16-5-2)7(8(9,10)11)12-6(3)13/h7H,4-5H2,1-3H3,(H,12,13)/t7-/m0/s1.
What are the key properties of N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide?
N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide has a molecular weight of 326.54 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2,2-trichloro-1-diethoxyphosphorylethyl]acetamide is sourced from PubChem (CID 2305152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).