C13H24F3N2O4P — CID 4061196
1-cyclohexyl-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)urea (PubChem CID 4061196) has the molecular formula C13H24F3N2O4P and a molecular weight of 360.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)urea.
| Compound Name | 1-cyclohexyl-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 4061196 |
| Molecular Formula | C13H24F3N2O4P |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-cyclohexyl-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)urea |
| SMILES | CCOP(=O)(OCC)C(NC(=O)NC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H24F3N2O4P/c1-3-21-23(20,22-4-2)11(13(14,15)16)18-12(19)17-10-8-6-5-7-9-10/h10-11H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | RBUYSMZSSMHTCJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|