C14H27N3O3 — CID 44614601
ethyl N-[(1S)-1-(cyclohexylcarbamoylamino)-2-methylpropyl]carbamate (PubChem CID 44614601) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl N-[(1S)-1-(cyclohexylcarbamoylamino)-2-methylpropyl]carbamate.
| Compound Name | ethyl N-[(1S)-1-(cyclohexylcarbamoylamino)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 44614601 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | ethyl N-[(1S)-1-(cyclohexylcarbamoylamino)-2-methylpropyl]carbamate |
| SMILES | CCOC(=O)N[C@H](NC(=O)NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C14H27N3O3/c1-4-20-14(19)17-12(10(2)3)16-13(18)15-11-8-6-5-7-9-11/h10-12H,4-9H2,1-3H3,(H,17,19)(H2,15,16,18)/t12-/m0/s1 |
| InChIKey | HCRSNJLVSFCJIH-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|