C13H16Cl4NO4P — CID 2830396
4-chloro-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzamide (PubChem CID 2830396) has the molecular formula C13H16Cl4NO4P and a molecular weight of 423.06 g/mol. Its IUPAC name is 4-chloro-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzamide.
| Compound Name | 4-chloro-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzamide |
|---|---|
| PubChem CID | 2830396 |
| Molecular Formula | C13H16Cl4NO4P |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | 4-chloro-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl4NO4P/c1-3-21-23(20,22-4-2)12(13(15,16)17)18-11(19)9-5-7-10(14)8-6-9/h5-8,12H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | NOFKAGPTBQZIGO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|