C14H29F3O7P2 — CID 13179232
(1-dipropoxyphosphoryl-2,2,2-trifluoroethyl) dipropyl phosphate (PubChem CID 13179232) has the molecular formula C14H29F3O7P2 and a molecular weight of 428.32 g/mol. Its IUPAC name is (1-dipropoxyphosphoryl-2,2,2-trifluoroethyl) dipropyl phosphate.
| Compound Name | (1-dipropoxyphosphoryl-2,2,2-trifluoroethyl) dipropyl phosphate |
|---|---|
| PubChem CID | 13179232 |
| Molecular Formula | C14H29F3O7P2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (1-dipropoxyphosphoryl-2,2,2-trifluoroethyl) dipropyl phosphate |
| SMILES | CCCOP(=O)(OCCC)OC(C(F)(F)F)P(=O)(OCCC)OCCC |
| InChI | InChI=1S/C14H29F3O7P2/c1-5-9-20-25(18,21-10-6-2)13(14(15,16)17)24-26(19,22-11-7-3)23-12-8-4/h13H,5-12H2,1-4H3 |
| InChIKey | UUUQTSJHEGMTDZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|