C11H25O4P — CID 21027105
1-(2-diethoxyphosphorylethoxy)-2,2-dimethylpropane (PubChem CID 21027105) has the molecular formula C11H25O4P and a molecular weight of 252.29 g/mol. Its IUPAC name is 1-(2-diethoxyphosphorylethoxy)-2,2-dimethylpropane.
| Compound Name | 1-(2-diethoxyphosphorylethoxy)-2,2-dimethylpropane |
|---|---|
| PubChem CID | 21027105 |
| Molecular Formula | C11H25O4P |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(2-diethoxyphosphorylethoxy)-2,2-dimethylpropane |
| SMILES | CCOP(=O)(CCOCC(C)(C)C)OCC |
| InChI | InChI=1S/C11H25O4P/c1-6-14-16(12,15-7-2)9-8-13-10-11(3,4)5/h6-10H2,1-5H3 |
| InChIKey | QAVKGBLRTRSADD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|