C23H45O11P — CID 130320253
3-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne (PubChem CID 130320253) has the molecular formula C23H45O11P and a molecular weight of 528.58 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne.
| Compound Name | 3-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne |
|---|---|
| PubChem CID | 130320253 |
| Molecular Formula | C23H45O11P |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCP(=O)(OCC)OCC |
| InChI | InChI=1S/C23H45O11P/c1-4-7-25-8-9-26-10-11-27-12-13-28-14-15-29-16-17-30-18-19-31-20-21-32-22-23-35(24,33-5-2)34-6-3/h1H,5-23H2,2-3H3 |
| InChIKey | UKSGAJLRCOHMKI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|