C13H8F21O4P — CID 87338288
bis(2,2,3,3-tetrafluoropropyl) 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl phosphate (PubChem CID 87338288) has the molecular formula C13H8F21O4P and a molecular weight of 658.13 g/mol. Its IUPAC name is bis(2,2,3,3-tetrafluoropropyl) 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl phosphate.
| Compound Name | bis(2,2,3,3-tetrafluoropropyl) 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl phosphate |
|---|---|
| PubChem CID | 87338288 |
| Molecular Formula | C13H8F21O4P |
| Molecular Weight | 658.13 g/mol |
| Exact Mass | 657.98 |
| IUPAC Name | bis(2,2,3,3-tetrafluoropropyl) 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl phosphate |
| SMILES | O=P(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F21O4P/c14-4(15)6(18,19)1-36-39(35,37-2-7(20,21)5(16)17)38-3-8(22,23)9(24,25)10(26,27)11(28,29)12(30,31)13(32,33)34/h4-5H,1-3H2 |
| InChIKey | AIQWVTSXKJWFMB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.13 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|