C22H12F40NO8P2- — CID 165364093
azanium bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl hydrogen phosphate) (PubChem CID 165364093) has the molecular formula C22H12F40NO8P2- and a molecular weight of 1240.21 g/mol. Its IUPAC name is azanium bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl hydrogen phosphate).
| Compound Name | azanium bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl hydrogen phosphate) |
|---|---|
| PubChem CID | 165364093 |
| Molecular Formula | C22H12F40NO8P2- |
| Molecular Weight | 1240.21 g/mol |
| Exact Mass | 1239.94 |
| IUPAC Name | azanium bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl hydrogen phosphate) |
| SMILES | O=P([O-])(O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.O=P([O-])(O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[NH4+] |
| InChI | InChI=1S/2C11H5F20O4P.H3N/c2*12-2(13)4(16,17)6(20,21)8(24,25)10(28,29)11(30,31)9(26,27)7(22,23)5(18,19)3(14,15)1-35-36(32,33)34;/h2*2H,1H2,(H2,32,33,34);1H3/p-1 |
| InChIKey | LRTHMHTXAKXBEJ-UHFFFAOYSA-M |
| XLogP | 11.27 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1240.21 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|