C8H3F13O2 — CID 98454961
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-difluoroacetate (PubChem CID 98454961) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-difluoroacetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-difluoroacetate |
|---|---|
| PubChem CID | 98454961 |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-difluoroacetate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C8H3F13O2/c9-2(10)3(22)23-1-4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h2H,1H2 |
| InChIKey | PHULMTATNVXQRF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|