C12H10F12O6 — CID 122607499
(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-methoxycarbonyloxyoctyl) methyl carbonate (PubChem CID 122607499) has the molecular formula C12H10F12O6 and a molecular weight of 478.18 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-methoxycarbonyloxyoctyl) methyl carbonate.
| Compound Name | (2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-methoxycarbonyloxyoctyl) methyl carbonate |
|---|---|
| PubChem CID | 122607499 |
| Molecular Formula | C12H10F12O6 |
| Molecular Weight | 478.18 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | (2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-methoxycarbonyloxyoctyl) methyl carbonate |
| SMILES | COC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)OC |
| InChI | InChI=1S/C12H10F12O6/c1-27-5(25)29-3-7(13,14)9(17,18)11(21,22)12(23,24)10(19,20)8(15,16)4-30-6(26)28-2/h3-4H2,1-2H3 |
| InChIKey | NAEBWLOFSGDJDI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|