C9H2F18O5S — CID 18995408
[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethyl] trifluoromethanesulfonate (PubChem CID 18995408) has the molecular formula C9H2F18O5S and a molecular weight of 564.14 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethyl] trifluoromethanesulfonate.
| Compound Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18995408 |
| Molecular Formula | C9H2F18O5S |
| Molecular Weight | 564.14 g/mol |
| Exact Mass | 563.93 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F18O5S/c10-2(11,1-30-33(28,29)9(25,26)27)31-7(21,22)8(23,24)32-6(19,20)4(14,15)3(12,13)5(16,17)18/h1H2 |
| InChIKey | UHGKHUAABGCWJA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|