C16H18F16O6S — CID 18359579
8-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-7-fluorooctane-1-sulfonic acid (PubChem CID 18359579) has the molecular formula C16H18F16O6S and a molecular weight of 642.35 g/mol. Its IUPAC name is 8-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-7-fluorooctane-1-sulfonic acid.
| Compound Name | 8-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-7-fluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 18359579 |
| Molecular Formula | C16H18F16O6S |
| Molecular Weight | 642.35 g/mol |
| Exact Mass | 642.06 |
| IUPAC Name | 8-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-7-fluorooctane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCC(F)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F16O6S/c17-9(5-3-1-2-4-6-39(33,34)35)7-36-8-10(18,19)37-15(29,30)16(31,32)38-14(27,28)12(22,23)11(20,21)13(24,25)26/h9H,1-8H2,(H,33,34,35) |
| InChIKey | ZBLDBIRLRJYVAW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|