C15H20F10O2 — CID 54475859
(9S)-9-fluoro-10-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-1-ene (PubChem CID 54475859) has the molecular formula C15H20F10O2 and a molecular weight of 422.30 g/mol. Its IUPAC name is (9S)-9-fluoro-10-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-1-ene.
| Compound Name | (9S)-9-fluoro-10-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-1-ene |
|---|---|
| PubChem CID | 54475859 |
| Molecular Formula | C15H20F10O2 |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (9S)-9-fluoro-10-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-1-ene |
| SMILES | C=CCCCCCC[C@H](F)COCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F10O2/c1-2-3-4-5-6-7-8-11(16)9-26-10-12(17,18)14(22,23)27-15(24,25)13(19,20)21/h2,11H,1,3-10H2/t11-/m0/s1 |
| InChIKey | XLNJBBIQBSJHOM-NSHDSACASA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|