C24H42O — CID 88718946
4-dodeca-1,11-dien-4-yloxydodeca-1,11-diene (PubChem CID 88718946) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 4-dodeca-1,11-dien-4-yloxydodeca-1,11-diene.
| Compound Name | 4-dodeca-1,11-dien-4-yloxydodeca-1,11-diene |
|---|---|
| PubChem CID | 88718946 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 4-dodeca-1,11-dien-4-yloxydodeca-1,11-diene |
| SMILES | C=CCCCCCCC(CC=C)OC(CC=C)CCCCCCC=C |
| InChI | InChI=1S/C24H42O/c1-5-9-11-13-15-17-21-23(19-7-3)25-24(20-8-4)22-18-16-14-12-10-6-2/h5-8,23-24H,1-4,9-22H2 |
| InChIKey | YYUOLLOUKATVCJ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|