C23H43BrO — CID 146462897
10-(4-bromobutoxy)nonadeca-1,18-diene (PubChem CID 146462897) has the molecular formula C23H43BrO and a molecular weight of 415.50 g/mol. Its IUPAC name is 10-(4-bromobutoxy)nonadeca-1,18-diene.
| Compound Name | 10-(4-bromobutoxy)nonadeca-1,18-diene |
|---|---|
| PubChem CID | 146462897 |
| Molecular Formula | C23H43BrO |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 10-(4-bromobutoxy)nonadeca-1,18-diene |
| SMILES | C=CCCCCCCCC(CCCCCCCC=C)OCCCCBr |
| InChI | InChI=1S/C23H43BrO/c1-3-5-7-9-11-13-15-19-23(25-22-18-17-21-24)20-16-14-12-10-8-6-4-2/h3-4,23H,1-2,5-22H2 |
| InChIKey | BUESPOGEWDHJQJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|