C14H23F5 — CID 20579541
12,12,13,13,13-pentafluoro-8-methyltridec-1-ene (PubChem CID 20579541) has the molecular formula C14H23F5 and a molecular weight of 286.33 g/mol. Its IUPAC name is 12,12,13,13,13-pentafluoro-8-methyltridec-1-ene.
| Compound Name | 12,12,13,13,13-pentafluoro-8-methyltridec-1-ene |
|---|---|
| PubChem CID | 20579541 |
| Molecular Formula | C14H23F5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 12,12,13,13,13-pentafluoro-8-methyltridec-1-ene |
| SMILES | C=CCCCCCC(C)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F5/c1-3-4-5-6-7-9-12(2)10-8-11-13(15,16)14(17,18)19/h3,12H,1,4-11H2,2H3 |
| InChIKey | YHYUSHFFJMLHIK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|