C17H29F5O — CID 91073069
ethane;1,1,1,2,2-pentafluoro-6-methyltetradec-13-en-7-one (PubChem CID 91073069) has the molecular formula C17H29F5O and a molecular weight of 344.41 g/mol. Its IUPAC name is ethane;1,1,1,2,2-pentafluoro-6-methyltetradec-13-en-7-one.
| Compound Name | ethane;1,1,1,2,2-pentafluoro-6-methyltetradec-13-en-7-one |
|---|---|
| PubChem CID | 91073069 |
| Molecular Formula | C17H29F5O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | ethane;1,1,1,2,2-pentafluoro-6-methyltetradec-13-en-7-one |
| SMILES | C=CCCCCCC(=O)C(C)CCCC(F)(F)C(F)(F)F.CC |
| InChI | InChI=1S/C15H23F5O.C2H6/c1-3-4-5-6-7-10-13(21)12(2)9-8-11-14(16,17)15(18,19)20;1-2/h3,12H,1,4-11H2,2H3;1-2H3 |
| InChIKey | CUIYBXARBCLAGZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|