C10H9F13O7S — CID 158094318
3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid (PubChem CID 158094318) has the molecular formula C10H9F13O7S and a molecular weight of 520.22 g/mol. Its IUPAC name is 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 158094318 |
| Molecular Formula | C10H9F13O7S |
| Molecular Weight | 520.22 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C10H9F13O7S/c11-5(12,4-27-2-1-3-31(24,25)26)28-6(13,14)7(15,16)29-8(17,18)9(19,20)30-10(21,22)23/h1-4H2,(H,24,25,26) |
| InChIKey | IFTBKSKYAYYLRW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|