C7H5F9O5 — CID 122438608
[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] methyl carbonate (PubChem CID 122438608) has the molecular formula C7H5F9O5 and a molecular weight of 340.09 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] methyl carbonate.
| Compound Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] methyl carbonate |
|---|---|
| PubChem CID | 122438608 |
| Molecular Formula | C7H5F9O5 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] methyl carbonate |
| SMILES | COC(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C7H5F9O5/c1-18-3(17)19-2-4(8,9)20-5(10,11)6(12,13)21-7(14,15)16/h2H2,1H3 |
| InChIKey | YPTOZTRMTRMVMT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|