C10H7F13O5 — CID 122456553
[2,2-difluoro-2-[1,1,2,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate (PubChem CID 122456553) has the molecular formula C10H7F13O5 and a molecular weight of 454.14 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate.
| Compound Name | [2,2-difluoro-2-[1,1,2,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate |
|---|---|
| PubChem CID | 122456553 |
| Molecular Formula | C10H7F13O5 |
| Molecular Weight | 454.14 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate |
| SMILES | COC(=O)OCC(F)(F)OC(F)(F)C(F)(CF)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13O5/c1-25-4(24)26-3-6(13,14)28-9(20,21)5(12,2-11)27-10(22,23)7(15,16)8(17,18)19/h2-3H2,1H3 |
| InChIKey | DSKBVPDUZSRVAP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.14 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|