C10H5F15O5 — CID 122459246
[2,2-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate (PubChem CID 122459246) has the molecular formula C10H5F15O5 and a molecular weight of 490.12 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate.
| Compound Name | [2,2-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate |
|---|---|
| PubChem CID | 122459246 |
| Molecular Formula | C10H5F15O5 |
| Molecular Weight | 490.12 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl] methyl carbonate |
| SMILES | COC(=O)OCC(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O5/c1-27-3(26)28-2-4(11,12)29-10(24,25)6(15,8(19,20)21)30-9(22,23)5(13,14)7(16,17)18/h2H2,1H3 |
| InChIKey | XFPLZQPJERWOHM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|