C8H7F9O4 — CID 122458002
[2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] methyl carbonate (PubChem CID 122458002) has the molecular formula C8H7F9O4 and a molecular weight of 338.12 g/mol. Its IUPAC name is [2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] methyl carbonate.
| Compound Name | [2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] methyl carbonate |
|---|---|
| PubChem CID | 122458002 |
| Molecular Formula | C8H7F9O4 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl] methyl carbonate |
| SMILES | COC(=O)OCC(F)(CF)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F9O4/c1-19-4(18)20-3-5(10,2-9)21-8(16,17)6(11,12)7(13,14)15/h2-3H2,1H3 |
| InChIKey | LFRBHQYMHSGPJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|