C11H2F20O4 — CID 71672959
2,2,2-trifluoroethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate (PubChem CID 71672959) has the molecular formula C11H2F20O4 and a molecular weight of 578.09 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate.
| Compound Name | 2,2,2-trifluoroethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 71672959 |
| Molecular Formula | C11H2F20O4 |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.96 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
| SMILES | O=C(OCC(F)(F)F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H2F20O4/c12-3(13,14)1-33-2(32)4(15,7(19,20)21)34-11(30,31)6(18,9(25,26)27)35-10(28,29)5(16,17)8(22,23)24/h1H2 |
| InChIKey | KHWPAUPJHDJXJC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|