C14H11F17O4 — CID 163010920
pentyl (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate (PubChem CID 163010920) has the molecular formula C14H11F17O4 and a molecular weight of 566.20 g/mol. Its IUPAC name is pentyl (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate.
| Compound Name | pentyl (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 163010920 |
| Molecular Formula | C14H11F17O4 |
| Molecular Weight | 566.20 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | pentyl (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
| SMILES | CCCCCOC(=O)[C@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F17O4/c1-2-3-4-5-33-6(32)7(15,10(19,20)21)34-14(30,31)9(18,12(25,26)27)35-13(28,29)8(16,17)11(22,23)24/h2-5H2,1H3/t7-,9+/m0/s1 |
| InChIKey | RWBBTDYOAWSTFY-IONNQARKSA-N |
| XLogP | 6.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.20 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|