C15H18F10O8 — CID 59257455
methyl (2S)-2-[2-[[2-[1,1-difluoro-2-[(2S)-3-oxobutan-2-yl]oxyethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]propanoate (PubChem CID 59257455) has the molecular formula C15H18F10O8 and a molecular weight of 516.28 g/mol. Its IUPAC name is methyl (2S)-2-[2-[[2-[1,1-difluoro-2-[(2S)-3-oxobutan-2-yl]oxyethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]propanoate.
| Compound Name | methyl (2S)-2-[2-[[2-[1,1-difluoro-2-[(2S)-3-oxobutan-2-yl]oxyethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]propanoate |
|---|---|
| PubChem CID | 59257455 |
| Molecular Formula | C15H18F10O8 |
| Molecular Weight | 516.28 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | methyl (2S)-2-[2-[[2-[1,1-difluoro-2-[(2S)-3-oxobutan-2-yl]oxyethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethoxy]propanoate |
| SMILES | COC(=O)[C@H](C)OCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)CO[C@@H](C)C(C)=O |
| InChI | InChI=1S/C15H18F10O8/c1-7(26)8(2)29-5-11(16,17)31-13(20,21)14(22,23)33-15(24,25)32-12(18,19)6-30-9(3)10(27)28-4/h8-9H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | FXJZMPWFDYZRED-IUCAKERBSA-N |
| XLogP | 3.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|