C15H16F10O7 — CID 58536590
[2-[[2-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethyl] 2-methylpropanoate (PubChem CID 58536590) has the molecular formula C15H16F10O7 and a molecular weight of 498.27 g/mol. Its IUPAC name is [2-[[2-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethyl] 2-methylpropanoate.
| Compound Name | [2-[[2-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 58536590 |
| Molecular Formula | C15H16F10O7 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [2-[[2-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-difluoromethoxy]-2,2-difluoroethyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)COC(=O)C(C)C |
| InChI | InChI=1S/C15H16F10O7/c1-7(2)9(26)28-5-11(16,17)30-13(20,21)14(22,23)32-15(24,25)31-12(18,19)6-29-10(27)8(3)4/h8H,1,5-6H2,2-4H3 |
| InChIKey | HLKKNEXEWZDDKA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|