C17H28O6 — CID 88566374
[2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methyl-2-(2-methylpropanoyloxy)propanoate (PubChem CID 88566374) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methyl-2-(2-methylpropanoyloxy)propanoate.
| Compound Name | [2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methyl-2-(2-methylpropanoyloxy)propanoate |
|---|---|
| PubChem CID | 88566374 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methyl-2-(2-methylpropanoyloxy)propanoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)COC(=O)C(C)(C)OC(=O)C(C)C |
| InChI | InChI=1S/C17H28O6/c1-11(2)13(18)21-9-16(5,6)10-22-15(20)17(7,8)23-14(19)12(3)4/h12H,1,9-10H2,2-8H3 |
| InChIKey | JNSIXPRILGGBRN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|