C13H11F10O7 — CID 58536587
CID 58536587 (PubChem CID 58536587) has the molecular formula C13H11F10O7 and a molecular weight of 469.20 g/mol.
| Compound Name | CID 58536587 |
|---|---|
| PubChem CID | 58536587 |
| Molecular Formula | C13H11F10O7 |
| Molecular Weight | 469.20 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | — |
| SMILES | C=CC(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)COC(=O)[CH]C |
| InChI | InChI=1S/C13H11F10O7/c1-3-7(24)26-5-9(14,15)28-11(18,19)12(20,21)30-13(22,23)29-10(16,17)6-27-8(25)4-2/h3-4H,1,5-6H2,2H3 |
| InChIKey | FDBKUYHRTKQULC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|