C15H5F23O6 — CID 137451006
[2-[2-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,3,3,3-tetrafluoropropyl] prop-2-enoate (PubChem CID 137451006) has the molecular formula C15H5F23O6 and a molecular weight of 718.15 g/mol. Its IUPAC name is [2-[2-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,3,3,3-tetrafluoropropyl] prop-2-enoate.
| Compound Name | [2-[2-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,3,3,3-tetrafluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 137451006 |
| Molecular Formula | C15H5F23O6 |
| Molecular Weight | 718.15 g/mol |
| Exact Mass | 717.97 |
| IUPAC Name | [2-[2-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,3,3,3-tetrafluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)OC(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H5F23O6/c1-2-4(39)40-3-5(16,8(19,20)21)41-12(31,32)6(17,9(22,23)24)42-13(33,34)7(18,10(25,26)27)43-15(37,38)44-14(35,36)11(28,29)30/h2H,1,3H2 |
| InChIKey | ZRQSGHZAKOSQSW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.15 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|