C26H34F10N2O11 — CID 154595641
prop-2-enoyloxymethyl 6-[[3-[[2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]carbonylamino]cyclohexyl]carbamoyloxy]hexanoate (PubChem CID 154595641) has the molecular formula C26H34F10N2O11 and a molecular weight of 740.54 g/mol. Its IUPAC name is prop-2-enoyloxymethyl 6-[[3-[[2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]carbonylamino]cyclohexyl]carbamoyloxy]hexanoate.
| Compound Name | prop-2-enoyloxymethyl 6-[[3-[[2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]carbonylamino]cyclohexyl]carbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 154595641 |
| Molecular Formula | C26H34F10N2O11 |
| Molecular Weight | 740.54 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | prop-2-enoyloxymethyl 6-[[3-[[2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]carbonylamino]cyclohexyl]carbamoyloxy]hexanoate |
| SMILES | C=CC(=O)OCOC(=O)CCCCCOC(=O)NC1CCCC(NC(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)CC)C1 |
| InChI | InChI=1S/C26H34F10N2O11/c1-3-18(39)45-15-46-19(40)11-6-5-7-12-43-20(41)37-16-9-8-10-17(13-16)38-21(42)44-14-23(29,30)47-24(31,32)25(33,34)49-26(35,36)48-22(27,28)4-2/h3,16-17H,1,4-15H2,2H3,(H,37,41)(H,38,42) |
| InChIKey | GDNNETUCPAORSQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|