C29H49F2N3O9 — CID 59245603
2-[7-[[3-[(2,2-difluoro-2-propoxyethoxy)carbonylamino]-1-methylcyclohexyl]methylcarbamoyloxy]heptoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 59245603) has the molecular formula C29H49F2N3O9 and a molecular weight of 621.72 g/mol. Its IUPAC name is 2-[7-[[3-[(2,2-difluoro-2-propoxyethoxy)carbonylamino]-1-methylcyclohexyl]methylcarbamoyloxy]heptoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[7-[[3-[(2,2-difluoro-2-propoxyethoxy)carbonylamino]-1-methylcyclohexyl]methylcarbamoyloxy]heptoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59245603 |
| Molecular Formula | C29H49F2N3O9 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | 2-[7-[[3-[(2,2-difluoro-2-propoxyethoxy)carbonylamino]-1-methylcyclohexyl]methylcarbamoyloxy]heptoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCCCCCOC(=O)NCC1(C)CCCC(NC(=O)OCC(F)(F)OCCC)C1 |
| InChI | InChI=1S/C29H49F2N3O9/c1-5-15-43-29(30,31)21-42-27(38)34-23-12-11-13-28(4,19-23)20-33-26(37)41-17-10-8-6-7-9-16-40-25(36)32-14-18-39-24(35)22(2)3/h23H,2,5-21H2,1,3-4H3,(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | GPWFGTHKWTUGQA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|