C25H48N2O4 — CID 58338815
heptyl N-[3-[2-(heptoxycarbonylamino)ethyl]-3-methylcyclohexyl]carbamate (PubChem CID 58338815) has the molecular formula C25H48N2O4 and a molecular weight of 440.67 g/mol. Its IUPAC name is heptyl N-[3-[2-(heptoxycarbonylamino)ethyl]-3-methylcyclohexyl]carbamate.
| Compound Name | heptyl N-[3-[2-(heptoxycarbonylamino)ethyl]-3-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 58338815 |
| Molecular Formula | C25H48N2O4 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.36 |
| IUPAC Name | heptyl N-[3-[2-(heptoxycarbonylamino)ethyl]-3-methylcyclohexyl]carbamate |
| SMILES | CCCCCCCOC(=O)NCCC1(C)CCCC(NC(=O)OCCCCCCC)C1 |
| InChI | InChI=1S/C25H48N2O4/c1-4-6-8-10-12-19-30-23(28)26-18-17-25(3)16-14-15-22(21-25)27-24(29)31-20-13-11-9-7-5-2/h22H,4-21H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | SOYDGPAKJPUWSP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|