C31H52N2O11 — CID 170087554
2-[2-[6-[2-[6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexoxy]propanoyloxy]hexoxy]propanoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 170087554) has the molecular formula C31H52N2O11 and a molecular weight of 628.76 g/mol. Its IUPAC name is 2-[2-[6-[2-[6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexoxy]propanoyloxy]hexoxy]propanoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[6-[2-[6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexoxy]propanoyloxy]hexoxy]propanoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170087554 |
| Molecular Formula | C31H52N2O11 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 2-[2-[6-[2-[6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexoxy]propanoyloxy]hexoxy]propanoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCCCCOC(C)C(=O)OCCCCCCOC(C)C(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C31H52N2O11/c1-23(2)28(35)42-21-15-32-27(34)25(5)39-17-11-7-9-13-19-41-30(37)26(6)40-18-12-8-10-14-20-44-31(38)33-16-22-43-29(36)24(3)4/h25-26H,1,3,7-22H2,2,4-6H3,(H,32,34)(H,33,38) |
| InChIKey | XTSDAXVFAYGVIC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|