C22H39NO6 — CID 170127966
4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]butyl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 170127966) has the molecular formula C22H39NO6 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]butyl 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | 4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]butyl 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 170127966 |
| Molecular Formula | C22H39NO6 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]butyl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCCOC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H39NO6/c1-16(2)18(24)28-14-11-23-20(26)29-13-10-9-12-27-19(25)17(22(6,7)8)15-21(3,4)5/h17H,1,9-15H2,2-8H3,(H,23,26) |
| InChIKey | HKQLVHGGRDNITR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|