About 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate
2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 145419012) has the molecular formula C15H29NO3
and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate |
| PubChem CID | 145419012 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC(=O)NCCOC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO3/c1-11(17)16-8-9-19-13(18)12(15(5,6)7)10-14(2,3)4/h12H,8-10H2,1-7H3,(H,16,17) |
| InChIKey | MYMXJEGMWXIWNG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate?
The IUPAC name of 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate (CID 145419012) is 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate.
What is the SMILES notation for 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate?
The canonical SMILES for 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate is CC(=O)NCCOC(=O)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate?
The InChIKey is MYMXJEGMWXIWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3/c1-11(17)16-8-9-19-13(18)12(15(5,6)7)10-14(2,3)4/h12H,8-10H2,1-7H3,(H,16,17).
What are the key properties of 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate?
2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate has a molecular weight of 271.40 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoethyl 2-tert-butyl-4,4-dimethylpentanoate is sourced from PubChem (CID 145419012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).