C23H24F20O4 — CID 91422677
[2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethyl] 2-methylprop-2-enoate;1,2,4-tris(1,1-difluoroethyl)-5-ethyl-1,2,3,3,4,5,6,6-octafluorocyclohexane (PubChem CID 91422677) has the molecular formula C23H24F20O4 and a molecular weight of 744.40 g/mol. Its IUPAC name is [2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethyl] 2-methylprop-2-enoate;1,2,4-tris(1,1-difluoroethyl)-5-ethyl-1,2,3,3,4,5,6,6-octafluorocyclohexane.
| Compound Name | [2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethyl] 2-methylprop-2-enoate;1,2,4-tris(1,1-difluoroethyl)-5-ethyl-1,2,3,3,4,5,6,6-octafluorocyclohexane |
|---|---|
| PubChem CID | 91422677 |
| Molecular Formula | C23H24F20O4 |
| Molecular Weight | 744.40 g/mol |
| Exact Mass | 744.14 |
| IUPAC Name | [2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)ethyl] 2-methylprop-2-enoate;1,2,4-tris(1,1-difluoroethyl)-5-ethyl-1,2,3,3,4,5,6,6-octafluorocyclohexane |
| SMILES | C=C(C)C(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC.CCC1(F)C(F)(F)C(F)(C(C)(F)F)C(F)(C(C)(F)F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C14H14F14.C9H10F6O4/c1-5-9(21)10(22,6(2,15)16)14(27,28)12(24,8(4,19)20)11(23,7(3,17)18)13(9,25)26;1-5(2)6(16)18-4-7(10,11)19-9(14,15)8(12,13)17-3/h5H2,1-4H3;1,4H2,2-3H3 |
| InChIKey | BERZYAIXWVYMMF-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.40 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|