C9H12F9O6P — CID 122456269
[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] diethyl phosphate (PubChem CID 122456269) has the molecular formula C9H12F9O6P and a molecular weight of 418.15 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] diethyl phosphate.
| Compound Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] diethyl phosphate |
|---|---|
| PubChem CID | 122456269 |
| Molecular Formula | C9H12F9O6P |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C9H12F9O6P/c1-3-20-25(19,21-4-2)22-5-6(10,11)23-7(12,13)8(14,15)24-9(16,17)18/h3-5H2,1-2H3 |
| InChIKey | HVSDAQXZZBNPQD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|