C13H30O8P2 — CID 518173
(3-diethoxyphosphoryloxy-2,2-dimethylpropyl) diethyl phosphate (PubChem CID 518173) has the molecular formula C13H30O8P2 and a molecular weight of 376.32 g/mol. Its IUPAC name is (3-diethoxyphosphoryloxy-2,2-dimethylpropyl) diethyl phosphate.
| Compound Name | (3-diethoxyphosphoryloxy-2,2-dimethylpropyl) diethyl phosphate |
|---|---|
| PubChem CID | 518173 |
| Molecular Formula | C13H30O8P2 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (3-diethoxyphosphoryloxy-2,2-dimethylpropyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC(C)(C)COP(=O)(OCC)OCC |
| InChI | InChI=1S/C13H30O8P2/c1-7-16-22(14,17-8-2)20-11-13(5,6)12-21-23(15,18-9-3)19-10-4/h7-12H2,1-6H3 |
| InChIKey | ZPBIIRXTRJJZTQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|