About aluminum;triethyl phosphate;phosphate
aluminum;triethyl phosphate;phosphate (PubChem CID 174993171) has the molecular formula C6H15AlO8P2
and a molecular weight of 304.11 g/mol. Its IUPAC name is aluminum;triethyl phosphate;phosphate.
Molecular Properties
| Compound Name | aluminum;triethyl phosphate;phosphate |
| PubChem CID | 174993171 |
| Molecular Formula | C6H15AlO8P2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | aluminum;triethyl phosphate;phosphate |
| SMILES | CCOP(=O)(OCC)OCC.O=P([O-])([O-])[O-].[Al+3] |
| InChI | InChI=1S/C6H15O4P.Al.H3O4P/c1-4-8-11(7,9-5-2)10-6-3;;1-5(2,3)4/h4-6H2,1-3H3;;(H3,1,2,3,4)/q;+3;/p-3 |
| InChIKey | ZRXCDIJCGBITSV-UHFFFAOYSA-K |
| XLogP | -1.00 |
| TPSA | 131.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aluminum;triethyl phosphate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;triethyl phosphate;phosphate?
The IUPAC name of aluminum;triethyl phosphate;phosphate (CID 174993171) is aluminum;triethyl phosphate;phosphate.
What is the SMILES notation for aluminum;triethyl phosphate;phosphate?
The canonical SMILES for aluminum;triethyl phosphate;phosphate is CCOP(=O)(OCC)OCC.O=P([O-])([O-])[O-].[Al+3].
What is the InChIKey of aluminum;triethyl phosphate;phosphate?
The InChIKey is ZRXCDIJCGBITSV-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H15O4P.Al.H3O4P/c1-4-8-11(7,9-5-2)10-6-3;;1-5(2,3)4/h4-6H2,1-3H3;;(H3,1,2,3,4)/q;+3;/p-3.
What are the key properties of aluminum;triethyl phosphate;phosphate?
aluminum;triethyl phosphate;phosphate has a molecular weight of 304.11 g/mol, XLogP of -1.00, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;triethyl phosphate;phosphate is sourced from PubChem (CID 174993171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).