About copper bis(diethyl phosphate)
copper bis(diethyl phosphate) (PubChem CID 23448356) has the molecular formula C8H20CuO8P2
and a molecular weight of 369.73 g/mol. Its IUPAC name is copper bis(diethyl phosphate).
Molecular Properties
| Compound Name | copper bis(diethyl phosphate) |
| PubChem CID | 23448356 |
| Molecular Formula | C8H20CuO8P2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | copper bis(diethyl phosphate) |
| SMILES | CCOP(=O)([O-])OCC.CCOP(=O)([O-])OCC.[Cu+2] |
| InChI | InChI=1S/2C4H11O4P.Cu/c2*1-3-7-9(5,6)8-4-2;/h2*3-4H2,1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | IVMWOIBXPXOUSW-UHFFFAOYSA-L |
| XLogP | 1.05 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper bis(diethyl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(diethyl phosphate)?
The IUPAC name of copper bis(diethyl phosphate) (CID 23448356) is copper bis(diethyl phosphate).
What is the SMILES notation for copper bis(diethyl phosphate)?
The canonical SMILES for copper bis(diethyl phosphate) is CCOP(=O)([O-])OCC.CCOP(=O)([O-])OCC.[Cu+2].
What is the InChIKey of copper bis(diethyl phosphate)?
The InChIKey is IVMWOIBXPXOUSW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H11O4P.Cu/c2*1-3-7-9(5,6)8-4-2;/h2*3-4H2,1-2H3,(H,5,6);/q;;+2/p-2.
What are the key properties of copper bis(diethyl phosphate)?
copper bis(diethyl phosphate) has a molecular weight of 369.73 g/mol, XLogP of 1.05, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(diethyl phosphate) is sourced from PubChem (CID 23448356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).