C7H3F11O4 — CID 11739882
methyl 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propanoate (PubChem CID 11739882) has the molecular formula C7H3F11O4 and a molecular weight of 360.08 g/mol. Its IUPAC name is methyl 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propanoate.
| Compound Name | methyl 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 11739882 |
| Molecular Formula | C7H3F11O4 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | methyl 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propanoate |
| SMILES | COC(=O)C(F)(OC(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H3F11O4/c1-20-2(19)3(8,4(9,10)11)21-5(12,13)6(14,15)22-7(16,17)18/h1H3 |
| InChIKey | YHCQGNKRUPRZMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|