C8F14O6 — CID 129405214
[(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoyl] (2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propaneperoxoate (PubChem CID 129405214) has the molecular formula C8F14O6 and a molecular weight of 458.05 g/mol. Its IUPAC name is [(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoyl] (2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propaneperoxoate.
| Compound Name | [(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoyl] (2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propaneperoxoate |
|---|---|
| PubChem CID | 129405214 |
| Molecular Formula | C8F14O6 |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | [(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoyl] (2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propaneperoxoate |
| SMILES | O=C(OOC(=O)[C@@](F)(OC(F)(F)F)C(F)(F)F)[C@@](F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8F14O6/c9-3(5(11,12)13,27-7(17,18)19)1(23)25-26-2(24)4(10,6(14,15)16)28-8(20,21)22/t3-,4-/m1/s1 |
| InChIKey | YPISTIQOQNFKKA-QWWZWVQMSA-N |
| XLogP | 3.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|