C11H7F11N2O3 — CID 87421745
methyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,4,4-heptafluoro-4-imidazol-1-ylbutoxy)propanoate (PubChem CID 87421745) has the molecular formula C11H7F11N2O3 and a molecular weight of 424.17 g/mol. Its IUPAC name is methyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,4,4-heptafluoro-4-imidazol-1-ylbutoxy)propanoate.
| Compound Name | methyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,4,4-heptafluoro-4-imidazol-1-ylbutoxy)propanoate |
|---|---|
| PubChem CID | 87421745 |
| Molecular Formula | C11H7F11N2O3 |
| Molecular Weight | 424.17 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | methyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,4,4-heptafluoro-4-imidazol-1-ylbutoxy)propanoate |
| SMILES | COC(=O)C(F)(OC(F)(F)C(F)(F)C(F)C(F)(F)n1ccnc1)C(F)(F)F |
| InChI | InChI=1S/C11H7F11N2O3/c1-26-6(25)8(15,10(18,19)20)27-11(21,22)7(13,14)5(12)9(16,17)24-3-2-23-4-24/h2-5H,1H3 |
| InChIKey | CVDXUFPYNZZZAF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|