C6H3F7N2 — CID 87105356
1-(1,1,2,2,3,3,3-heptafluoropropyl)imidazole (PubChem CID 87105356) has the molecular formula C6H3F7N2 and a molecular weight of 236.09 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)imidazole.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)imidazole |
|---|---|
| PubChem CID | 87105356 |
| Molecular Formula | C6H3F7N2 |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)imidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)n1ccnc1 |
| InChI | InChI=1S/C6H3F7N2/c7-4(8,5(9,10)11)6(12,13)15-2-1-14-3-15/h1-3H |
| InChIKey | UJLLQKITFJHJBR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|